|
| Watchedfields = changed
| verifiedrevid = 377858461
| ImageFile = zymosterol.png
| ImageSize =200px
| ImageFile1 = Zymosterol molecule ball.png
|IUPACName=(3''S'',5''S'',10''S'',13''R'',14''R'',17''R'')-10,13-dimethyl-17-[(2''R'')-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol ▼| ImageSize1 = 250
|OtherNames=5α-Cholesta-8,24-dien-3β-ol ▼| ImageAlt1 = Ball-and-stick model of zymosterol
▲| OtherNames IUPACName = 5α-Cholesta-8,24-dien-3β-ol
▲| IUPACName SystematicName = ( 31'' SR'', 53a'' SR'', 105a''S'', 137'' RS'', 149a'' RS'', 1711a''R'')- 109a, 1311a- dimethylDimethyl- 171-[(2''R'')-6-methylhept-5-en-2-yl]-2,3 ,3a,4,5 ,5a,6,7, 118, 129, 149a, 1510, 1611, 1711a- dodecahydrotetradecahydro-1''H''-cyclopenta[''a'']phenanthren- 37-ol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 128-33-6
| CASNo_RefUNII_Ref = {{ cascitefdacite|correct| ??FDA}} ▼| PubChem=92746
| UNII = PU2755PT4O
▲| CASNo_Ref = {{cascite|correct|??}}
| CASNoPubChem = 128-33-692746
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} ▼| PubChem = 92746
▲| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 83724
| SMILES = O[C@H]4CC[C@@]3(/C2=C(/[C@@H]1CC[C@H]([C@H](C)CC\C=C(/C)C)[C@@]1(C)CC2)CC[C@H]3C4)C
| InChI = 1/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1
| InChIKey = CGSJXLIKVBJVRY-XTGBIJOFBJ
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CGSJXLIKVBJVRY-XTGBIJOFSA-N }}
|Section2={{Chembox Properties
| Formula = C<sub>27</sub>H<sub>44</sub>O
| MolarMass = 384.64 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| Autoignition=
}}
}}
'''Zymosterol''' is aan intermediate in [[cholesterol]] intermediate in the cholesterol biosynthesis.. Disregarding some intermediate compounds (e.g. 4-4-dimethylzymosterol) [[lanosterol]] can be considered a precursor of zymosterol in the cholesterol synthesis pathway. The conversion of zymosterol into cholesterol happens in the [[endoplasmic reticulum]]. Zymosterol accumulates quickly in the plasma membrane coming from the [[cytosol]]. The movement of zymosterol across the cytosol is more than twice as fast as the movement of cholesterol itself.
[[Category:Cholestanes]]
[[Category:Sterols]]
|
