Content deleted Content added
Updating {{drugbox}} (no changed fields - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'CAS_number_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:Wik... |
Fixed spacing between stub template and category templates. |
||
(25 intermediate revisions by 20 users not shown) | |||
Line 1:
{{short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444655127
| IUPAC_name = N-(4-amino-2-methylquinolin-6-yl)-2-[(4-ethylphenoxy)methyl]benzamide
| image = JTC-801.
| width = 200
Line 15 ⟶ 18:
| legal_US =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
Line 22 ⟶ 25:
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 244218-51-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7I21WLZ2FP
| ATC_prefix =
| ATC_suffix =
| PubChem = 5311339▼
| IUPHAR_ligand = 1692
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4470841
| smiles = O=C(c1ccccc1COc2ccc(cc2)CC)Nc3ccc4nc(cc(c4c3)N)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C26H25N3O2/c1-3-18-8-11-21(12-9-18)31-16-19-6-4-5-7-22(19)26(30)29-20-10-13-25-23(15-20)24(27)14-17(2)28-25/h4-15H,3,16H2,1-2H3,(H2,27,28)(H,29,30)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = VTGBZWHPJFMTKS-UHFFFAOYSA-N
<!--Chemical data-->
| C=26 | H=25 | N=3 | O=2
| synonyms = JTC-801
}}
'''JTC-801''' is an [[opioid]] [[analgesic]] drug used in scientific research.<ref>{{cite journal |
JTC-801 is a selective antagonist for the [[nociceptin receptor]], also known as the ORL-1 receptor.<ref>{{cite journal |
JTC-801 is an orally active drug that blocks the nociceptin receptor and produces analgesic effects in a variety of animal studies, and is particularly useful for [[neuropathic pain]] and [[allodynia]] associated with nerve injury.<ref>{{cite journal |
== See also ==
* [[J-113,397]]
* [[LY-2940094]]
* [[SB-612,111]]
== References ==
{{
{{Opioidergics}}
[[Category:Synthetic opioids]]
Line 58 ⟶ 72:
[[Category:Aromatic amines]]
[[Category:Phenol ethers]]
[[Category:Nociceptin receptor antagonists]]
{{analgesic-stub}}
|