Content deleted Content added
mNo edit summary |
m Open access bot: doi updated in citation with #oabot. |
||
| (28 intermediate revisions by 16 users not shown) | |||
Line 1:
{{Chembox
3,4-divanillyltetrahydrofuran is a lignan found in a [[Urtica dioica]] (stinging nettle) subspecies. This same compound may also be found in other lignan‐containing plant sources such as [[Linum usitatissimum]] (flax seed).▼
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477217559
| ImageFile = Divanillyltetrahydrofuran.svg
| ImageSize = 200px
| IUPACName = 3,3′-Dimethoxy-9,9′-epoxylignane-4,4′-diol
| SystematicName = 4,4′-[Oxolane-3,4-diylbis(methylene)]bis(2-methoxyphenol)
| OtherNames = 3,4-Divanilyltetrahydrofuran; α,α'-(Tetrahydro-3,4-furandiyl)dicreosol
|Section1={{Chembox Identifiers
| CASNo = 34730-78-4
| CASNo_Ref = {{cascite|changed|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 158474
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 405043
| PubChem = 182210
| SMILES = Oc1ccc(cc1OC)CC3COCC3Cc2cc(OC)c(O)cc2
| InChI = 1/C20H24O5/c1-23-19-9-13(3-5-17(19)21)7-15-11-25-12-16(15)8-14-4-6-18(22)20(10-14)24-2/h3-6,9-10,15-16,21-22H,7-8,11-12H2,1-2H3
| InChIKey = ROGUIJKVZZROIQ-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H24O5/c1-23-19-9-13(3-5-17(19)21)7-15-11-25-12-16(15)8-14-4-6-18(22)20(10-14)24-2/h3-6,9-10,15-16,21-22H,7-8,11-12H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ROGUIJKVZZROIQ-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| Formula = C<sub>20</sub>H<sub>24</sub>O<sub>5</sub>
| MolarMass = 344.40 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
▲'''3,4-
The compound has been found to occupy binding sites of [[Shbg|sex-hormone binding globulin]] (SHBG), thereby reducing the ability of SHBG to bind additional steroid hormones such as estrogens and androgens, mostly testosterone and estradiol. Certain extracts of stinging nettle are therefore used by some bodybuilders in an effort to increase free [[testosterone]]<ref>Schöttner M, Gansser D, Spiteller G. Interaction of lignans with human sex hormone binding globulin (SHBG). " Z Naturforsch [C]". 1997 Nov–Dec;52(11–12):834–43.</ref>.▼
▲The compound has been found to occupy binding sites of [[
== References ==
{{Reflist}}
{{DEFAULTSORT:Divanillyltetrahydrofuran, 3,4-}}
[[Category:Lignans]]
[[Category:Tetrahydrofurans]]
[[Category:Urtica]]
| |||