Content deleted Content added
m Open access bot: doi updated in citation with #oabot. |
|||
(23 intermediate revisions by 14 users not shown) | |||
Line 1:
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477217559
| ImageFile = Divanillyltetrahydrofuran.svg
| ImageSize = 200px
| IUPACName =
| SystematicName = 4,4′-[Oxolane-3,4-diylbis(methylene)]bis(2-methoxyphenol)
| OtherNames = 3,4-Divanilyltetrahydrofuran; α,α'-(Tetrahydro-3,4-furandiyl)dicreosol
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 182210▼
|
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| SMILES = Oc1ccc(cc1OC)CC3COCC3Cc2cc(OC)c(O)cc2▼
| ChEMBL = 405043
| InChI = 1/C20H24O5/c1-23-19-9-13(3-5-17(19)21)7-15-11-25-12-16(15)8-14-4-6-18(22)20(10-14)24-2/h3-6,9-10,15-16,21-22H,7-8,11-12H2,1-2H3▼
| InChIKey = ROGUIJKVZZROIQ-UHFFFAOYAP▼
| StdInChI = 1S/C20H24O5/c1-23-19-9-13(3-5-17(19)21)7-15-11-25-12-16(15)8-14-4-6-18(22)20(10-14)24-2/h3-6,9-10,15-16,21-22H,7-8,11-12H2,1-2H3▼
▲|
| StdInChIKey = ROGUIJKVZZROIQ-UHFFFAOYSA-N▼
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
▲|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|
| Formula = C
| MolarMass = 344.40 g/mol
|
|
|
|
| Solubility =
}}
|
|
|
|
}}
}}
'''3,4-Divanillyltetrahydrofuran''' is a [[lignan]] found in
The compound has been found to occupy binding sites of [[sex hormone-binding globulin]] (SHBG), thereby reducing the ability of SHBG to bind additional steroid hormones such as estrogens and androgens, mostly testosterone and estradiol. Certain extracts of stinging nettle are therefore used by some bodybuilders in an effort to increase free [[testosterone]].<ref>{{cite journal | author = Schöttner M
== References ==
{{Reflist}}
Line 40 ⟶ 50:
[[Category:Lignans]]
[[Category:Tetrahydrofurans]]
[[Category:
|