Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation |
removed Category:Nitrobenzene derivatives; added Category:2-Nitrophenyl compounds using HotCat |
||
(21 intermediate revisions by 19 users not shown) | |||
Line 1:
{{Short description|Antihypertensive drug of the calcium channel blocker class}}
{{Drugbox
| alt = Skeletal formula of aranidipine
| image2 = Aranidipine-3D-balls.png
| alt2 = Ball-and-stick model of the aranidipine molecule
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|aranidipine}}
| pregnancy_category = ▼
| routes_of_administration = Oral▼
<!--Pharmacokinetic data-->
| elimination_half-life = ▼
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| ChEMBL = 2104030
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2139
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}▼
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4Y7UR6X2PO
▲| verifiedrevid = 443289552
▲| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl)
▲| image = Aranidipine.svg
▲| CAS_number = 86780-90-7
▲| ATC_prefix = none
▲| ATC_suffix =
▲| ATC_supplemental =
▲| PubChem = 2225
▲| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
▲| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01562
<!--Chemical data-->
|
| smiles = CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
▲| bioavailability =
| StdInChI = 1S/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3
▲| protein_bound =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
▲| metabolism =
| StdInChIKey = NCUCGYYHUFIYNU-UHFFFAOYSA-N
▲| elimination_half-life =
▲| excretion =
▲| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
▲| pregnancy_US = <!-- A / B / C / D / X -->
▲| pregnancy_category=
▲| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
▲| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
▲| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
▲| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
▲| legal_status = Rx-only
▲| routes_of_administration = Oral
}}
'''Aranidipine''' ([[International Nonproprietary Name|INN]], trade name '''Sapresta''') is a [[calcium channel blocker]]. It is a dihydropyridine derivative with two active metabolites (M-1α and M-1β). It was developed by Maruko Seiyaku and has the formula methyl 2-oxopropyl 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylate. Its main use is as a hypotensive, reducing blood pressure.<ref>{{cite web |title=Aranidipine |url=https://pubchem.ncbi.nlm.nih.gov/compound/aranidipine#section=Top |website=PubMed |access-date=23 December 2018}}</ref><ref>{{cite book | vauthors = Gelatsis P | chapter = To Market, to Market – 1996| veditors = Bristol JA, Robertson DW, Doherty AM, Hagmann WK, Plattner JJ, Wong WW, Trainor GL |title=Annual Reports in Medicinal Chemistry |date=1997 |publisher=Academic Press |location=San Diego |isbn=978-0-08-058376-1 |page=306 | chapter-url=https://books.google.com/books?id=oJY8LrP_JysC&dq=Aranidipine&pg=PA306}}</ref>
==References==
{{Reflist}}
{{Calcium channel blockers}}
Line 42 ⟶ 64:
[[Category:Carboxylate esters]]
[[Category:Ketones]]
[[Category:
[[Category:Methyl esters]]
|