Aranidipine: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

Revision as of 13:36, 16 August 2011 edit CheMoBot (talk \| contribs) Bots 141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation ← Previous edit		Latest revision as of 11:53, 29 September 2024 edit undo JWBE (talk \| contribs) Extended confirmed users 9,145 edits removed Category:Nitrobenzene derivatives; added Category:2-Nitrophenyl compounds using HotCat
(21 intermediate revisions by 19 users not shown)
Line 1: {{Short description\|Antihypertensive drug of the calcium channel blocker class}} ~~{{drugbox~~ {{Drugbox \| verifiedrevid = ~~443289552~~458034815▼ \| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl)▼ \| image = Aranidipine.svg▼ \| alt = Skeletal formula of aranidipine \| image2 = Aranidipine-3D-balls.png \| alt2 = Ball-and-stick model of the aranidipine molecule <!--Clinical data--> \| tradename = \| Drugs.com = {{drugs.com\|international\|aranidipine}} \| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->▼ \| pregnancy_US = <!-- A / B / C / D / X -->▼ \| pregnancy_category = ▼ \| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->▼ \| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->▼ \| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->▼ \| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->▼ \| legal_status = Rx-only▼ \| routes_of_administration = Oral▼ <!--Pharmacokinetic data--> \| bioavailability = = ▼ \| protein_bound = = ▼ \| metabolism = = ▼ \| elimination_half-life = ▼ \| excretion = ▼ <!--Identifiers--> \| CAS_number_Ref = {{cascite\|correct\|??}} \| CAS_number = 86780-90-7▼ \| ATC_prefix = none▼ \| ATC_suffix = = ▼ \| ATC_supplemental = ▼ \| PubChem = 2225▼ \| ChEMBL = 2104030 \| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}} \| ChemSpiderID = 2139 \| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}▼ \| DrugBank = = ▼ \| UNII_Ref = {{fdacite\|correct\|FDA}} \| UNII = 4Y7UR6X2PO ▲\| verifiedrevid = 443289552 ▲\| IUPAC_name = ''O''5-methyl ''O''3-(2-oxopropyl) ~~2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate~~ ▲\| image = Aranidipine.svg ▲\| CAS_number = 86780-90-7 ~~\| CAS_supplemental =~~ ▲\| ATC_prefix = none ▲\| ATC_suffix = ▲\| ATC_supplemental = ▲\| PubChem = 2225 ▲\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}} ▲\| DrugBank = \| KEGG_Ref = {{keggcite\|correct\|kegg}} \| KEGG = D01562 ~~\| C=19 \| H=20 \| N=2 \| O=7~~ <!--Chemical data--> ~~\| molecular_weight = 388.37 g/mol~~ \| ~~smiles~~ C=19 \| H=20 \| N=2 \| O=7 \| smiles = CC1=C(C(C(=C(N1)C)C(=O)OCC(=O)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC \| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}} ▲\| bioavailability = \| StdInChI = 1S/C19H20N2O7/c1-10(22)9-28-19(24)16-12(3)20-11(2)15(18(23)27-4)17(16)13-7-5-6-8-14(13)21(25)26/h5-8,17,20H,9H2,1-4H3 ▲\| protein_bound = \| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}} ▲\| metabolism = \| StdInChIKey = NCUCGYYHUFIYNU-UHFFFAOYSA-N ▲\| elimination_half-life = ▲\| excretion = ▲\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> ▲\| pregnancy_US = <!-- A / B / C / D / X --> ▲\| pregnancy_category= ▲\| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> ▲\| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> ▲\| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> ▲\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> ▲\| legal_status = Rx-only ▲\| routes_of_administration = Oral }} '''Aranidipine''' ([[International Nonproprietary Name\|INN]], trade name '''Sapresta''') is a [[calcium channel blocker]]. It is a dihydropyridine derivative with two active metabolites (M-1α and M-1β). It was developed by Maruko Seiyaku and has the formula methyl 2-oxopropyl 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylate. Its main use is as a hypotensive, reducing blood pressure.<ref>{{cite web \|title=Aranidipine \|url=https://pubchem.ncbi.nlm.nih.gov/compound/aranidipine#section=Top \|website=PubMed \|access-date=23 December 2018}}</ref><ref>{{cite book \| vauthors = Gelatsis P \| chapter = To Market, to Market – 1996\| veditors = Bristol JA, Robertson DW, Doherty AM, Hagmann WK, Plattner JJ, Wong WW, Trainor GL \|title=Annual Reports in Medicinal Chemistry \|date=1997 \|publisher=Academic Press \|location=San Diego \|isbn=978-0-08-058376-1 \|page=306 \| chapter-url=https://books.google.com/books?id=oJY8LrP_JysC&dq=Aranidipine&pg=PA306}}</ref> ~~'''Aranidipine''' ([[International Nonproprietary Name\|INN]], trade name '''Sapresta''') is a [[calcium channel blocker]].~~ ==References== {{Reflist}} {{Calcium channel blockers}} Line 42 ⟶ 64: [[Category:Carboxylate esters]] [[Category:Ketones]] [[Category:~~Nitrobenzenes~~2-Nitrophenyl compounds]] [[Category:Methyl esters]]