Revision as of 19:23, 5 August 2013 edit Edgar181 (talk \| contribs) Extended confirmed users 196,325 edits Unnecessary ← Previous edit		Revision as of 04:56, 27 November 2014 edit undo DePiep (talk \| contribs) Extended confirmed users 294,285 edits fix double parameter in Drugbox, per CAT:DUPARG. (m.: rm overuse of whitespace) using AWB Next edit →
Line 3: \| Watchedfields = changed \| verifiedrevid = 377858461 \| ImageFile = zymosterol.png \| ImageSize = 200px \| IUPACName = (3''S'',5''S'',10''S'',13''R'',14''R'',17''R'')-10,13-dimethyl-17-[(2''R'')-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-ol \| OtherNames = 5α-Cholesta-8,24-dien-3β-ol \|Section1={{Chembox Identifiers \| CASNo_Ref = {{cascite\|correct\|??}} \| CASNo = 128-33-6 \| PubChem = 92746 \| CASNo_Ref = {{cascite\|correct\|??}} \| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}}▼ ~~\| CASNo = 128-33-6~~ ~~\| PubChem = 92746~~ ▲\| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}} \| ChemSpiderID = 83724 \| SMILES = O[C@H]4CC[C@@]3(/C2=C(/[C@@H]1CC[C@H]([C@H](C)CC\C=C(/C)C)[C@@]1(C)CC2)CC[C@H]3C4)C \| InChI = 1/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1 \| InChIKey = CGSJXLIKVBJVRY-XTGBIJOFBJ \| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}} \| StdInChI = 1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1 \| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}} \| StdInChIKey = CGSJXLIKVBJVRY-XTGBIJOFSA-N }} \|Section2={{Chembox Properties \| Formula = C<sub>27</sub>H<sub>44</sub>O \| MolarMass = 384.64 g/mol \| Appearance= \| Density= \| MeltingPt= \| BoilingPt= \| Solubility= }} \|Section3={{Chembox Hazards \| MainHazards= \| FlashPt= \| AutoignitionPt = ~~\| Autoignition=~~ }} }}

Zymosterol: Difference between revisions