Homosalate: Difference between revisions
Content deleted Content added
حسن علي البط (talk | contribs) m Removed Category:Phenols (using HotCat) |
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID PubChem InChI1 InChIKey1 SMILES. |
||
| Line 8: | Line 8: | ||
| OtherNames = Homosalate |
| OtherNames = Homosalate |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| |
| ChemSpiderID = 8059 |
||
| PubChem = 8362 |
|||
| SMILES = OC1=CC=CC=C1C(OC2CC(C)CC(C)(C)C2)=O |
|||
| InChI1 = 1/C16H22O3/c1-11-8-12(10-16(2,3)9-11)19-15(18)13-6-4-5-7-14(13)17/h4-7,11-12,17H,8-10H2,1-3H3 |
|||
| ⚫ | |||
| InChIKey1 = WSSJONWNBBTCMG-UHFFFAOYAJ |
|||
| CASNo = 118-56-9 |
|||
| SMILES = O=C(OC1CC(CC(C1)(C)C)C)c2ccccc2O |
|||
| ⚫ | |||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
| Formula = C<sub>16</sub>H<sub>22</sub>O<sub>3</sub> |
| Formula = C<sub>16</sub>H<sub>22</sub>O<sub>3</sub> |
||
Revision as of 19:03, 30 October 2010
| |
| Names | |
|---|---|
| IUPAC name
3,3,5-Trimethylcyclohexyl 2-hydroxybenzoate
| |
| Other names
Homosalate
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | 100.003.874 |
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C16H22O3 | |
| Molar mass | 262.36 g/mol |
| Density | 1.045 g/cm3 |
| Melting point | <25 °C |
| Boiling point | 161-165 °C at 4 mmHg |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Homosalate is an organic compound used in some sunscreens. It is an ester formed from salicylic acid and 3,3,5-trimethylcyclohexanol, a derivative of cyclohexanol.
The salicylic acid portion of the molecule absorbs ultraviolet rays with a wavelength from 295 nm to 315 nm, protecting the skin from sun damage. The hydrophobic cyclohexanol portion provides greasiness that prevents it from dissolving in water.
References
- ^ Merck Index, 11th Edition, 4660
 | This article about an ester is a stub. You can help Wikipedia by expanding it. |