Jump to content

DPI-287: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
No edit summary
 
(14 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
⚫
{{drugbox | verifiedrevid = 410884595
{{Drugbox
|
⚫
| verifiedrevid = 430786118
⚫
| image = DPI-287.svg
| IUPAC_name = 4-[(R)-[(2S,5R)-2,5-dimethyl-4-benzylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N,N-diethylbenzamide
| IUPAC_name = 4-[(R)-[(2S,5R)-2,5-dimethyl-4-benzylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N,N-diethylbenzamide
⚫
| image = DPI-287.svg

<!--Clinical data-->
| tradename =
⚫
| legal_status =

<!--Identifiers-->
⚫
| CAS_number =
| PubChem = 21025820
| PubChem = 21025820

⚫
| C = 31 | H = 39 | N = 3 | O = 2
<!--Chemical data-->
| molecular_weight = 485.659 g/mol
⚫
| C=31 | H=39 | N=3 | O=2
| smiles = CCN(CC)C(=O)c2ccc(cc2)C(c(ccc4)cc4O)N(CC1C)C(C)CN1Cc3ccccc3
| smiles = CCN(CC)C(=O)c2ccc(cc2)C(c(ccc4)cc4O)N(CC1C)C(C)CN1Cc3ccccc3
⚫
| CAS_number =
⚫
| legal_status =
}}
}}


'''DPI-287''' is a drug that is used in scientific research. It is a highly selective [[agonist]] for the [[Delta opioid receptor|δ-opioid]] [[Receptor (biochemistry)|receptor]], which produces less [[convulsion]]s than most drugs from this family.<ref>{{cite journal | last1 = Jutkiewicz | first1 = EM | title = The antidepressant -like effects of delta-opioid receptor agonists | journal = Molecular interventions | volume = 6 | issue = 3 | pages = 162–9 | year = 2006 | pmid = 16809477 | doi = 10.1124/mi.6.3.7 }}</ref> It has [[antidepressant]] effects.<ref>Jutkiewicz EM, Chang KJ, Rice KC, Woods JH. (2005) Characterization of a novel nonpeptide delta-opioid agonist analog DPI287 with antidepressant-like activity. ''Experimental Biology meeting abstracts. FASEB J''. 19, Abstract # 874.4</ref>
'''DPI-287''' is an [[opioid]] [[drug]] that is used in scientific research. It is a highly selective [[agonist]] for the [[Delta opioid receptor|δ-opioid]] [[Receptor (biochemistry)|receptor]], which produces less [[convulsion]]s than most drugs from this family.<ref>{{cite journal | vauthors = Jutkiewicz EM | title = The antidepressant-like effects of delta-opioid receptor agonists | journal = Molecular Interventions | volume = 6 | issue = 3 | pages = 162–9 | date = June 2006 | pmid = 16809477 | doi = 10.1124/mi.6.3.7 }}</ref> It has [[antidepressant]]-like effects.<ref>{{cite journal | vauthors = Jutkiewicz EM, Chang KJ, Rice KC, Woods JH | date = 2005 | title = Characterization of a novel nonpeptide delta-opioid agonist analog DPI287 with antidepressant-like activity. | journal = Experimental Biology Meeting Abstracts | number = Abstract # 874.4 }}</ref>


==References==
==See also==
* [[AZD2327]]
<references/>
* [[BW373U86]]
⚫
* [[DPI-3290]]

== References ==
{{Reflist|2}}

{{Opioidergics}}


[[Category:Synthetic opioids]]
[[Category:Synthetic opioids]]
[[Category:Delta-opioid agonists]]
[[Category:Delta-opioid receptor agonists]]
[[Category:Benzamides]]
[[Category:Benzamides]]
[[Category:Piperazines]]
[[Category:Piperazines]]
[[Category:Phenols]]
[[Category:3-Hydroxyphenyl compounds]]
[[Category:Diethylamino compounds]]




{{analgesic-stub}}
{{analgesic-stub}}

⚫
[[sr:DPI-287]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"