Imiprothrin: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 396495200
+| Watchedfields = changed
-|Reference=<ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=33442|FLUKA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Imiprothrin] at [[Sigma-Aldrich]]</ref><ref name=EPA>[http://www.epa.gov/opprd001/factsheets/imiprothrin.pdf Pesticide Fact Sheet], [[U. S. Environmental Protection Agency]]</ref>
+| verifiedrevid = 422676078
-|ImageFile=Imiprothrin.svg
+| Name =
-|ImageSize=200px
+| Reference = <ref>[https://www.sigmaaldrich.com/catalog/product/SIAL/33442?lang=en Imiprothrin] at [[Sigma-Aldrich]]</ref><ref name="EPA">[https://www3.epa.gov/pesticides/chem_search/reg_actions/registration/fs_PC-004006_01-Mar-98.pdf Pesticide Fact Sheet: Imiprothrin], [[U. S. Environmental Protection Agency]], March 1998.</ref>
-|IUPACName=(2,5-Dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
+| ImageFile = Imiprothrin.svg
-|OtherNames=Pralle; Multicide
+| PIN = [2,5-Dioxo-3-(prop-2-yn-1-yl)imidazolidin-1-yl]methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate
-|Section1={{Chembox Identifiers
+| OtherNames = Pralle; Multicide
-|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| Section1 = {{Chembox Identifiers
-| ChemSpiderID = 11677252
-| InChI = 1/C16H20N2O4/c1-6-7-17-9-12(19)18(15(17)21)22-14(20)13-11(8-10(2)3)16(13,4)5/h1,8,11,13H,7,9H2,2-5H3
-| InChIKey = LCSQQWBCNOLPHM-UHFFFAOYAJ
-| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
-| StdInChI = 1S/C16H20N2O4/c1-6-7-17-9-12(19)18(15(17)21)22-14(20)13-11(8-10(2)3)16(13,4)5/h1,8,11,13H,7,9H2,2-5H3
-| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
-| StdInChIKey = LCSQQWBCNOLPHM-UHFFFAOYSA-N
 | CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo=72963-72-5
+| CASNo = 72963-72-5
+| ChEBI = 39389
-|  PubChem=123622
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-|  SMILES = O=C2N(OC(=O)C1C(/C=C(\C)C)C1(C)C)C(=O)CN2CC#C
+| ChemSpiderID = 110211
-}}
+| EC_number = 615-873-9
-|Section2={{Chembox Properties
+| KEGG = D01889
-|  C=17|H=22|N=2|O=4
+| PubChem = 123622
-|  Appearance=
+| UNII_Ref = {{fdacite|correct|FDA}}
-|  Density=0.979 g/mL
+| UNII = 73OFA861WY
-|  MeltingPt=
+| SMILES = O=C(OCN1C(=O)CN(C1=O)CC#C)C2C(\C=C(/C)C)C2(C)C
-|  BoilingPt=
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
-|  Solubility=
+| StdInChI = 1S/C17H22N2O4/c1-6-7-18-9-13(20)19(16(18)22)10-23-15(21)14-12(8-11(2)3)17(14,4)5/h1,8,12,14H,7,9-10H2,2-5H3
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = VPRAQYXPZIFIOH-UHFFFAOYSA-N
   }}
-|Section3={{Chembox Hazards
+| Section2 = {{Chembox Properties
+| C=17 | H=22 | N=2 | O=4
-|  MainHazards=
+| Appearance=Golden yellow liquid
-|  FlashPt=110 °C
+| Odor=Slightly sweet
-|  Autoignition=
+| Density=0.979 g/mL
-|  RPhrases = {{R22}} {{R50}}
+| MeltingPt=
-|  SPhrases = {{S61}}
+| BoilingPt=
+| Solubility=
   }}
+| Section3 = {{Chembox Hazards
+| MainHazards=
+| FlashPtC = 110
+| AutoignitionPtC =
+| GHSPictograms = {{GHS07}}{{GHS09}}
+| GHSSignalWord = Warning
+| HPhrases = {{H-phrases|302|410}}
+| PPhrases = {{P-phrases|264|270|273|301+312|330|391|501}}
+  }}
+| Section4 =
+| Section5 =
+| Section6 =
 }}
-'''Imiprothrin''' is a synthetic [[pyrethroid]] [[insecticide]].  It is an ingredient in some insecticide products for indoor use.<ref name=EPA/>  It has low acute toxicity to humans,<ref name=EPA/> but to insects it acts as a [[neurotoxin]] causing [[paralysis]].
+'''Imiprothrin''' is a synthetic [[pyrethroid]] [[insecticide]]. It is an ingredient in some commercial and consumer insecticide products for indoor use. It has low acute toxicity to humans through the [[inhalation]] and [[dermal]] routes, but to insects it acts as a [[neurotoxin]] causing [[paralysis]]. It is effective against [[cockroach]]es, [[wikt:water bug|waterbugs]], [[ant]]s, [[silverfish]], [[Grylloidea|crickets]] and [[spider]]s, among others.<ref name="EPA"/>
 ==References==
 {{reflist}}
 {{insecticides}}
-[[Category:Pyrethroids]]
+[[Category:Chrysanthemate esters]]
-[[Category:hydantoins]]
+[[Category:Hydantoins]]
-[[Category:alkynes]]
+[[Category:Cyclopropanes]]
+[[Category:Propargyl compounds]]
+{{hydrocarbon-stub}}
-[[cs:Imiprothrin]]
-[[hu:Imiprotrin]]
-[[pl:Imiprotryna]]