Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Nitrilotriacetic acid: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 456919350 of page Nitrilotriacetic_acid for the Chem/Drugbox validation project (updated: 'KEGG').
 
Martinlw (talk | contribs)
 
Line 1: Line 1:
{{chembox
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Nitrilotriacetic_acid|oldid=456919350}} 456919350] of page [[Nitrilotriacetic_acid]] with values updated to verified values.}}
{{Chembox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 394799915
| verifiedrevid = 462261723
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Nitrilotriacetic-acid-2D-skeletal.png
| ImageFile = Nitrilotriacetic-acid-2D-skeletal.png
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 150px
| ImageSize = 160
| ImageName = Wireframe model of nitrilotriacetic acid
| ImageName = Skeletal formula of nitrilotriacetic acid
| PIN = 2,2',2<nowiki>''</nowiki>-Nitrilotriacetic acid
| PIN = 2,2′,2′′-Nitrilotriacetic acid<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = [[Royal Society of Chemistry|The Royal Society of Chemistry]] | date = 2014 | location = Cambridge | pages = 21, 679 | doi = 10.1039/9781849733069 | isbn = 978-0-85404-182-4| last1 = Favre | first1 = Henri A. | last2 = Powell | first2 = Warren H. }}</ref>
| SystematicName = 2-[Bis(carboxymethyl)amino]acetic acid
| OtherNames = ''N'',''N''-Bis(carboxymethyl)glycine<br />2-[Bis(carboxymethyl)amino]acetic acid<ref name="pc1">{{cite web|title=Nitrilotriacetic Acid - Compound Summary|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8758&loc=ec_rcs|work=PubChem Compound|publisher=National Center for Biotechnology Information|access-date=13 July 2012|location=USA|date=26 March 2005|at=Identification}}</ref><br />Triglycine<ref>[http://www.chemspider.com/8428 Nitrilotriacetic acid]</ref> Trilon
| OtherNames = Triglycine
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| InChI1 = 1/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)
| InChIKey1 = MGFYIUFZLHCRTH-UHFFFAOYAZ
| CASNo = 139-13-9
| CASNo = 139-13-9
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Comment = (free acid)
| CASNo1 = 15934-02-8
| CASNo2 = 5064-31-3
| CASNo1_Comment = (monoammoniate)
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 71264-32-9
| CASNo2_Comment = (diammoniate)
| CASNo2_Comment = (trisodium salt)
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 8758
| UNII = KA90006V9D
| PubChem_Ref = {{Pubchemcite}}
| UNII1_Ref = {{fdacite|correct|FDA}}
| PubChem1 = 61821
| UNII1 = E3C8R2M0XD
| PubChem1_Comment = (monoammoniate)
| UNII1_Comment = (trisodium salt)
| PubChem1_Ref = {{Pubchemcite}}
| PubChem2 = 62259
| PubChem = 8758
| ChemSpiderID = 8428
| PubChem2_Comment = (diammoniate)
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem2_Ref = {{Pubchemcite}}
| PubChem3 = 16219712
| EINECS = 205-355-7
| UNNumber = 2811
| PubChem3_Comment = (monosodium)
| PubChem3_Ref = {{Pubchemcite}}
| PubChem4 = 23617736
| PubChem4_Comment = (monocalcium)
| PubChem4_Ref = {{Pubchemcite}}
| ChemSpiderID = 8428
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 55699
| ChemSpiderID1_Comment = (monoammoniate)
| ChemSpiderID1_Ref = {{Chemspidercite}}
| ChemSpiderID2 = 56063
| ChemSpiderID2_Comment = (diammoniate)
| ChemSpiderID2_Ref = {{Chemspidercite}}
| ChemSpiderID3 = 17347029
| ChemSpiderID3_Comment = (monosodium)
| ChemSpiderID3_Ref = {{Chemspidercite}}
| ChemSpiderID4 = 19954700
| ChemSpiderID4_Comment = (monocalcium)
| ChemSpiderID4_Ref = {{Chemspidercite}}
| EINECS = 205-355-7
| UNNumber = 2811
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB03040
| DrugBank = DB03040
| KEGG_Ref = {{keggcite|correct|kegg}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = <!-- blanked - oldvalue: C14695 -->
| KEGG = C14695
| KEGG_Ref = {{keggcite|changed|kegg}}
| MeSHName = Nitrilotriacetic+acid
| MeSHName = Nitrilotriacetic+Acid
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 44557
| ChEBI = 44557
| ChEBI_Ref = {{ebicite|correct|EBI}}
| RTECS = AJ0175000
| RTECS = AJ0175000
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| Beilstein = 1710776
| Gmelin = 3726
| SMILES = O=C(O)CN(CC(=O)O)CC(=O)O
| StdInChI = 1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)
| StdInChI = 1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MGFYIUFZLHCRTH-UHFFFAOYSA-N
| StdInChIKey = MGFYIUFZLHCRTH-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| SMILES = C(C(=O)O)N(CC(=O)O)CC(=O)O
| InChI = 1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)
| InChIKey = MGFYIUFZLHCRTH-UHFFFAOYSA-N
| Beilstein = 1710776
| Gmelin = 3726}}
|Section2= {{Chembox Properties
| C=6|H=9|N=1|O=6
| MolarMass=191.14 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
}}
|Section2={{Chembox Properties
| C=6 | H=9 | N=1 | O=6
| MolarMass = 191.14 <ref name=ChemBK />
| MeltingPtC = 246 <ref name=ChemBK />
| Solubility = Insoluble. <0.01 g/100 mL at 23°C <ref name=ChemBK />
| Appearance = White crystals
}}
|Section3={{Chembox Thermochemistry
| DeltaHf = −1.3130–−1.3108 MJ mol<sup>−1</sup>
}}
|Section4={{Chembox Hazards
| GHSPictograms = {{gHS exclamation mark}} {{gHS health hazard}}
| GHSSignalWord = '''WARNING'''
| HPhrases = {{h-phrases|302|319|351}}
| PPhrases = {{p-phrases|281|305+351+338}}
| FlashPtC = 100
| LD50 = 1.1 g kg<sup>−1</sup> <small>(oral, rat)</small>
}}
|Section5={{Chembox Related
| OtherFunction_label = alkanoic acids
| OtherFunction = {{unbulleted list|[[EDTA]]|[[Iminodiacetic acid]]|[[EDDS]]}}
| OtherCompounds = {{unbulleted list|[[Triethanolamine]]|[[Tris(2-aminoethyl)amine]]}}
}}
}}
'''Nitrilotriacetic acid''' (NTA) is the [[aminopolycarboxylic acid]] with the formula N(CH<sub>2</sub>CO<sub>2</sub>H)<sub>3</sub>. It is a colourless solid. Its conjugate base '''nitrilotriacetate''' is used as a [[chelating agent]] for Ca<sup>2+</sup>, Co<sup>2+</sup>, Cu<sup>2+</sup>, and Fe<sup>3+</sup>.<ref>[http://www.inchem.org/documents/iarc/vol48/48-12.html Nitrilotriacetic Acid and Its Salts], International Agency for Research on Cancer</ref>

==Production and use==
Nitrilotriacetic acid is commercially available as the free acid and as the sodium salt. It is produced from [[ammonia]], [[formaldehyde]], and [[sodium cyanide]] or [[hydrogen cyanide]]. Worldwide capacity is estimated at 100 thousand tonnes per year.<ref name = Ullmann>{{Ullmann | year=2022|doi = 10.1002/14356007.a17_377.pub3 | title = Nitrilotriacetic Acid | author = Thomas Schmidt, Charalampos Gousetis, Hans-Joachim Opgenorth}}</ref> NTA is also cogenerated as an impurity in the synthesis of [[EDTA]], arising from reactions of the ammonia coproduct.<ref name="Ullmann/Roger">Hart, J. Roger (2005) "Ethylenediaminetetraacetic Acid and Related Chelating Agents" in ''Ullmann's Encyclopedia of Industrial Chemistry'', Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a10_095}}</ref> Older routes to NTA included alkylation of ammonia with chloroacetic acid and oxidation of [[triethanolamine]].

==Coordination chemistry and applications==

The conjugate base of NTA is a [[Tripodal ligand|tripodal]] [[Tetradentate ligand|tetradentate]] trianionic ligand, forming [[coordination compound]]s with a variety of metal ions.<ref>{{cite journal|author=B. L. Barnett, V. A. Uchtman|title=Structural Investigations of Calcium-Binding Molecules. 4. Calcium Binding to Aminocarboxylates. Crystal Structures of Ca(CaEDTA)<sup>.</sup>7H<sub>2</sub>O and Na(CaNTA)|journal=Inorg. Chem.|year=1979|volume=18|issue=10 |pages=2674–2678|doi=10.1021/ic50200a007}}</ref>

Like [[EDTA]], its sodium salt is used for [[water softening]] to remove Ca<sup>2+</sup>. For this purpose, NTA is a replacement for [[triphosphate]], which once was widely used in detergents, and cleansers, but can cause [[eutrophication]] of lakes.

In one application, sodium NTA removes Cr, Cu, and As from wood that had been treated with [[chromated copper arsenate]].<ref>Fang-Chih, C.; Ya-Nang, W.; Pin-Jui, C.; Chun-Han, K. Factors affecting chelating extraction of Cr, Cu, and As from CCA-treated wood. J. Environ. Manag. 2013, 122.</ref>

===Laboratory uses===
In the laboratory, this compound is used in complexometric titrations. A variant of NTA is used for protein isolation and purification in the [[Polyhistidine-tag|His-tag]] method.<ref>{{cite journal|last1=Liu|first1=Weijing|title=Layer-by-Layer Deposition with Polymers Containing Nitrilotriacetate, A Convenient Route to Fabricate Metal- and Protein-Binding Films|journal=ACS Applied Materials & Interfaces|date=2016|volume=8|issue=16|pages=10164–73|doi=10.1021/acsami.6b00896|pmid=27042860}}</ref> The modified NTA is used to immobilize [[nickel]] on a solid support. This allows purification of proteins containing a tag consisting of six histidine residues at either terminus.<ref>[http://www1.qiagen.com/literature/handbooks/PDF/Protein/Expression/QXP_QIAexpressionist/1024473_QXPHB_0603.pdf qiaexpressionist]</ref>

The His-tag binds the metal of metal [[Chelation|chelator]] complexes. Previously, [[iminodiacetic acid]] was used for that purpose. Now, nitrilotriacetic acid is more commonly used.<ref>{{Cite journal|last1=Lauer|first1=Sabine A.|last2=Nolan|first2=John P.|date=2002|title=Development and characterization of Ni-NTA-bearing microspheres|journal=Cytometry|volume=48|issue=3|pages=136–145|doi=10.1002/cyto.10124|pmid=12116359|issn=1097-0320|doi-access=free}}</ref>

For laboratory uses, Ernst Hochuli et al. (1987) coupled the NTA ligand and nickel ions to [[agarose]] beads.<ref>{{Cite journal|last1=Hochuli|first1=E.|last2=Döbeli|first2=H.|last3=Schacher|first3=A.|date=January 1987|title=New metal chelate adsorbent selective for proteins and peptides containing neighbouring histidine residues|journal=Journal of Chromatography A|volume=411|pages=177–184|doi=10.1016/s0021-9673(00)93969-4|pmid=3443622|issn=0021-9673}}</ref> This [https://cube-biotech.com/products/purification-resins/his-affinity-resins/ni-nta-agarose/ Ni-NTA Agarose] is the most used tool to purify His-tagged proteins via affinity chromatography.
<gallery mode="packed" caption="NTA complexes" widths="500px" heights="100px" perrow="2">
Ni(NTA)(aq)23views.png|Three views of the structure of [Ni(NTA)(H<sub>2</sub>O)<sub>2</sub>]<sup>−</sup>.
File:Calcium complex of NTA trianion.svg|Structure of the nitrilotriacetate anion [Ca(NTA)(H<sub>2</sub>O)<sub>3</sub>]<sup>−</sup>.
</gallery>

==Toxicity and environment==
In contrast to EDTA, NTA is easily biodegradable and is almost completely removed during wastewater treatment.<ref name=Ullmann/> The environmental impacts of NTA are minimal. Despite widespread use in cleaning products, the concentration in the water supply is too low to have a sizeable impact on human health or environmental quality.<ref>Brouwer, N.; Terpstra, P. Ecological and Toxicological Properties of Nitrilotriacetic Acid (NTA) as a Detergent Builder. Tenside Surfactants Detergents 1995, 32, 225-228.</ref>

==Related compounds==
* [[N-Methyliminodiacetic acid]] (MIDA), the N-methyl derivative of IDA
* [[Imidodiacetic acid]], the amino diacetic acid
* [[N-(2-Carboxyethyl)iminodiacetic acid]], a more biodegradable analogue of NTA
* N-hydroxyiminodiacetic acid (HIDA), {{chem2|HON(CH2CO2H)2}} ([[registry number]] = 87339-38-6)<ref>{{cite journal |doi=10.1002/ejoc.200601053 |title=Stabilizing Factors for Vanadium(IV) in Amavadin |date=2007 |last1=Hubregtse |first1=Ton |last2=Hanefeld |first2=Ulf |last3=Arends |first3=Isabel W. C. E. |journal=European Journal of Organic Chemistry |volume=2007 |issue=15 |pages=2413–2422 }}</ref> See [[HIDA scan]].

==References==
{{reflist|refs=<ref name=ChemBK>ChemBK Chemical Database http://www.chembk.com/en/chem/Nitrilotriacetic%20acid</ref>}}

{{Authority control}}

[[Category:Amines]]
[[Category:Acetic acids]]
[[Category:Chelating agents]]
[[Category:IARC Group 2B carcinogens]]
[[Category:Tripodal ligands]]