Jump to content

Phloroglucinol carboxylic acid: Difference between revisions

Page 1
Page 2
Content deleted Content added
mNo edit summary
ChEBI ID added to CHEMBOX identifiers
 
(28 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 409540642
| Name = Phloroglucinol carboxylic acid
| Name = Phloroglucinol carboxylic acid
| ImageFile = Phloroglucinol carboxylic acid.png
| ImageFile = 2,4,6-Trihydroxybenzoic acid.svg
| ImageSize = 200px
| ImageName = Chemical structure of phloroglucinol carboxylic acid
| ImageName = Chemical structure of phloroglucinol carboxylic acid
| IUPACName = 2,4,6-trihydroxybenzoic acid
| PIN = 2,4,6-Trihydroxybenzoic acid
| OtherNames = PGCA<br>Phloroglucinic acid
| OtherNames = PGCA<br>Phloroglucinic acid
|Section1= {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 83-30-7
| CASNo = 83-30-7
| CASNo_Ref =
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| CASOther =
| UNII = 3NC0UQ5EMR
| PubChem = 66520
| PubChem = 66520
| SMILES = C1=C(C=C(C(=C1O)C(=O)O)O)O
| SMILES = C1=C(C=C(C(=C1O)C(=O)O)O)O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| InChI =
| ChemSpiderID = 59891
| ChEBI = 165217
| InChI = 1/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12)
| InChIKey = IBHWREHFNDMRPR-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = IBHWREHFNDMRPR-UHFFFAOYSA-N
| MeSHName =
| MeSHName =
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>7</sub>H<sub>6</sub>O<sub>5</sub>
| Formula = C<sub>7</sub>H<sub>6</sub>O<sub>5</sub>
| MolarMass = 170.11954 g/mol
| MolarMass = 170.11954 g/mol
| ExactMass = 170.021523 u
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt = <!-- °C -->
| MeltingPt =
| BoilingPt = <!-- °C -->
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
}}
}}
'''Phloroglucinol carboxylic acid''' is a [[trihydroxybenzoic acid]], a type of phenolic acid.
'''Phloroglucinol carboxylic acid''' is a [[trihydroxybenzoic acid]], a type of phenolic acid. It is a [[catechin]] degradation product excreted by the bacterium ''[[Acinetobacter calcoaceticus]]'' grown on catechin as sole source of carbon<ref>[http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6T1W-48DXJ40-2&_user=10&_coverDate=06%2F11%2F2003&_rdoc=1&_fmt=high&_orig=search&_sort=d&_docanchor=&view=c&_acct=C000050221&_version=1&_urlVersion=0&_userid=10&md5=1779b937ddf780ebe1cf697f79451a0d Degradation of (+)-catechin by Acinetobacter calcoaceticus MTC 127. M. Arunachalam, N. Mohan, R. Sugadev, P. Chellappan and A. Mahadevan, Biochimica et Biophysica Acta (BBA), Volume 1621, Issue 3, 11 June 2003, Pages 261-265, doi:10.1016/S0304-4165(03)00077-1]</ref>.


It is produced by ''[[Pseudomonas fluorescens]]''.<ref>Biosynthesis of Phloroglucinol. Jihane Achkar, Mo Xian, Huimin Zhao and J. W. Frost, J. AM. CHEM. SOC., 2005, volume 127, pages 5332-5333, {{doi|10.1021/ja042340g}}</ref> It is a [[catechin]] degradation product excreted by the bacterium ''[[Acinetobacter calcoaceticus]]'', a species of bacteria part of the human body normal flora, grown on catechin as sole source of carbon.<ref>M. Arunachalam, N. Mohan, R. Sugadev, P. Chellappan and A. Mahadevan: ''Degradation of (+)-catechin by Acinetobacter calcoaceticus MTC 127'', [[Biochimica et Biophysica Acta]] (BBA), Volume 1621, Issue 3, 11 June 2003, pages 261–265, {{doi|10.1016/S0304-4165(03)00077-1}}.</ref> It is also found in wine.<ref>C. García Barroso, R. Cela Torrijos and J. A. Pérez-Bustamante: ''HPLC separation of benzoic and hydroxycinnamic acids in wines'', [[Chromatographia]], Volume 17, Number 5, pages 249–252, {{doi|10.1007/BF02263033}}.</ref>
==References==

== References ==
{{reflist}}
{{reflist}}


Line 34: Line 47:


[[Category:Trihydroxybenzoic acids]]
[[Category:Trihydroxybenzoic acids]]
[[Category:Phloroglucinols]]


{{polyphenol-stub}}
{{aromatic-stub}}