Jump to content

SB-357134: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
PotatoBot (talk | contribs)
Bots
51,239 edits
m Stub sorting and placement of stub template(s): nervous-system-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.
cas from EPA
 
(27 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 407719698
| verifiedrevid = 449586967
| IUPAC_name = N-(2,5-Dibromo-3-fluorophenyl)-4-methoxy-3-(1-piperazinyl)benzenesulfonamide
| IUPAC_name = N-(2,5-Dibromo-3-fluorophenyl)-4-methoxy-3-(1-piperazinyl)benzenesulfonamide
| image = SB357134.png
| image = SB-357134.svg
| width = 240
| width = 240


Line 15: Line 17:
| legal_US =
| legal_US =
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
Line 22: Line 24:
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number =
| IUPHAR_ligand = 3235
| CAS_number_Ref = {{cascite|changed|EPA}}
| CAS_number = 219963-52-7
| ATC_prefix =
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
| PubChem = 6918553
| PubChem = 6918553
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 329383
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 5293750


<!--Chemical data-->
<!--Chemical data-->
| C=17 | H=18 | Br=2 | F=1 | N=3 | O=3 | S=1
| C=17 | H=18 | Br=2 | F=1 | N=3 | O=3 | S=1
| molecular_weight = 523.214 g/mol
| smiles = C3CNCCN3c1cc(ccc1OC)S(=O)(=O)Nc2cc(Br)cc(F)c2Br
| smiles = C3CNCCN3c1cc(ccc1OC)S(=O)(=O)Nc2cc(Br)cc(F)c2Br
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C17H18Br2FN3O3S/c1-26-16-3-2-12(10-15(16)23-6-4-21-5-7-23)27(24,25)22-14-9-11(18)8-13(20)17(14)19/h2-3,8-10,21-22H,4-7H2,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = BLWHAZZXRHTFJE-UHFFFAOYSA-N

| melting_point =
| melting_point =
| melting_high =
| melting_high =
}}
}}


'''SB-357,134''' is a drug which is used in scientific research. It acts as a potent, selective and orally active [[5-HT6 receptor|5-HT<sub>6</sub>]] [[Receptor (biochemistry)|receptor]] [[Antagonist (pharmacology)|antagonist]].<ref>{{cite journal | last1 = Bromidge | first1 = SM | last2 = Clarke | first2 = SE | last3 = Gager | first3 = T | last4 = Griffith | first4 = K | last5 = Jeffrey | first5 = P | last6 = Jennings | first6 = AJ | last7 = Joiner | first7 = GF | last8 = King | first8 = FD | last9 = Lovell | first9 = PJ | title = Phenyl benzenesulfonamides are novel and selective 5-HT6 antagonists: identification of N-(2,5-dibromo-3-fluorophenyl)-4-methoxy-3-piperazin-1-ylbenzenesulfonamide (SB-357134) | journal = Bioorganic & medicinal chemistry letters | volume = 11 | issue = 1 | pages = 55–8 | year = 2001 | pmid = 11140733 | doi=10.1016/S0960-894X(00)00597-7}}</ref> SB-357,134 and other 5-HT<sub>6</sub> antagonists show [[nootropic]] effects in animal studies,<ref>{{cite journal | last1 = Rogers | first1 = DC | last2 = Hagan | first2 = JJ | title = 5-HT6 receptor antagonists enhance retention of a water maze task in the rat | journal = Psychopharmacology | volume = 158 | issue = 2 | pages = 114–9 | year = 2001 | pmid = 11702084 | doi = 10.1007/s002130100840 }}</ref><ref>{{cite journal | last1 = Stean | first1 = TO | last2 = Hirst | first2 = WD | last3 = Thomas | first3 = DR | last4 = Price | first4 = GW | last5 = Rogers | first5 = D | last6 = Riley | first6 = G | last7 = Bromidge | first7 = SM | last8 = Serafinowska | first8 = HT | last9 = Smith | first9 = DR | title = Pharmacological profile of SB-357134: a potent, selective, brain penetrant, and orally active 5-HT(6) receptor antagonist | journal = Pharmacology, biochemistry, and behavior | volume = 71 | issue = 4 | pages = 645–54 | year = 2002 | pmid = 11888556 | doi=10.1016/S0091-3057(01)00742-0}}</ref><ref>{{cite journal | last1 = Perez-García | first1 = G | last2 = Meneses | first2 = A | title = Oral administration of the 5-HT6 receptor antagonists SB-357134 and SB-399885 improves memory formation in an autoshaping learning task | journal = Pharmacology, biochemistry, and behavior | volume = 81 | issue = 3 | pages = 673–82 | year = 2005 | pmid = 15964617 | doi = 10.1016/j.pbb.2005.05.005 }}</ref> and have been proposed as potential novel treatments for cognitive disorders such as [[schizophrenia]] and [[Alzheimer's disease]].
'''SB-357134''' is a drug which is used in scientific research. It acts as a potent, selective and orally active [[5-HT6 receptor|5-HT<sub>6</sub>]] [[Receptor (biochemistry)|receptor]] [[Antagonist (pharmacology)|antagonist]].<ref>{{cite journal | vauthors = Bromidge SM, Clarke SE, Gager T, Griffith K, Jeffrey P, Jennings AJ, Joiner GF, King FD, Lovell PJ, Moss SF, Newman H, Riley G, Rogers D, Routledge C, Serafinowska H, Smith DR | display-authors = 6 | title = Phenyl benzenesulfonamides are novel and selective 5-HT6 antagonists: identification of N-(2,5-dibromo-3-fluorophenyl)-4-methoxy-3-piperazin-1-ylbenzenesulfonamide (SB-357134) | journal = Bioorganic & Medicinal Chemistry Letters | volume = 11 | issue = 1 | pages = 55–8 | date = January 2001 | pmid = 11140733 | doi = 10.1016/S0960-894X(00)00597-7 }}</ref> SB-357134 and other 5-HT<sub>6</sub> antagonists show [[nootropic]] effects in animal studies,<ref>{{cite journal | vauthors = Rogers DC, Hagan JJ | title = 5-HT6 receptor antagonists enhance retention of a water maze task in the rat | journal = Psychopharmacology | volume = 158 | issue = 2 | pages = 114–9 | date = November 2001 | pmid = 11702084 | doi = 10.1007/s002130100840 | s2cid = 29472459 }}</ref><ref>{{cite journal | vauthors = Stean TO, Hirst WD, Thomas DR, Price GW, Rogers D, Riley G, Bromidge SM, Serafinowska HT, Smith DR, Bartlett S, Deeks N, Duxon M, Upton N | display-authors = 6 | title = Pharmacological profile of SB-357134: a potent, selective, brain penetrant, and orally active 5-HT(6) receptor antagonist | journal = Pharmacology, Biochemistry, and Behavior | volume = 71 | issue = 4 | pages = 645–54 | date = April 2002 | pmid = 11888556 | doi = 10.1016/S0091-3057(01)00742-0 | s2cid = 34925312 }}</ref><ref>{{cite journal | vauthors = Perez-García G, Meneses A | title = Oral administration of the 5-HT6 receptor antagonists SB-357134 and SB-399885 improves memory formation in an autoshaping learning task | journal = Pharmacology, Biochemistry, and Behavior | volume = 81 | issue = 3 | pages = 673–82 | date = July 2005 | pmid = 15964617 | doi = 10.1016/j.pbb.2005.05.005 | s2cid = 19789219 }}</ref> and have been proposed as potential novel treatments for cognitive disorders such as [[schizophrenia]] and [[Alzheimer's disease]].


==References==
== References ==
{{reflist}}
{{Reflist}}


{{Serotonergics}}
{{Serotonergics}}
Line 47: Line 59:


[[Category:5-HT6 antagonists]]
[[Category:5-HT6 antagonists]]
[[Category:Piperazines]]
[[Category:Phenol ethers]]
[[Category:Sulfonamides]]
[[Category:Sulfonamides]]
[[Category:Organobromides]]
[[Category:Bromoarenes]]
[[Category:Organofluorides]]
[[Category:Fluoroarenes]]
[[Category:1-Piperazinyl compounds]]




Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"