Tetuin: Difference between revisions

| verifiedrevid = 405878445

| Name = Tetuin

| ImageFile = Tetuin.svg

| ImageSize = 200px

| ImageName = Tetuin

| IUPACName = <nowiki>5,7-dihydroxy-2-phenyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6(hydroxymethyl)oxan-2-yl]oxychromen-4-one</nowiki>

| OtherNames = Baicalein 6-glucoside

| Section1 = {{Chembox Identifiers

| CASNo = 28279-72-3

| PubChem = 5321896

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| SMILES = C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)OC4C(C(C(C(O4)CO)O)O)O)O

| Section2 = {{Chembox Properties

| Formula = C₂₁H₂₀O₁₀

| MolarMass = 432.37 g/mol

| ExactMass = 432.105647 u

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| Autoignition = }}

'''Tetuin''' is a [[flavone]], a type of flavonoid. It is the 6-O-[[glucoside]] of [[baicalein]]. It can be isolated from the seeds of ''[[Oroxylum indicum]]'', the Indian trumpetflower<ref>Mehta and Metha, 1959</ref>, also known as टेटु ''tetu'' in Marathi.

{{Natural-phenol-stub}}

[[fr:Tétuine]]