Izvorni kod stranice Aniracetam

{{Drugbox-lat
| IUPAC_name        = 
| image             = Aniracetam2.svg
| width             = 
| alt               = 
| image2            = Aniracetam3Dan.gif
| width2            = 
| alt2              = 
| imagename         = 
| drug_name         = Aniracetam
| caption           =

<!-- Clinical data -->
| tradename         = AMPAMET, Draganon, Sarpul
| Drugs.com         = {{drugs.com-lat|monograph|Aniracetam}}
| MedlinePlus       = 
| licence_EU        = 
| licence_US        = 
| DailyMedID        = 
| pregnancy_AU      = 
| pregnancy_US      = 
| pregnancy_category= 
| legal_AU          = 
| legal_CA          = 
| legal_UK          = 
| legal_US          = 
| legal_status      = 
| dependency_liability = 
| routes_of_administration =

<!-- Pharmacokinetic data -->
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 1-2,5 h
| excretion         =

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number        = 72432-10-1
| CAS_supplemental  = 
| ATCvet            = 
| ATC_prefix        = N06
| ATC_suffix        = BX11
| ATC_supplemental  = 
| PubChem           = 2196
| PubChemSubstance  = 46506607
| IUPHAR_ligand     = 
| DrugBank_Ref      = {{drugbankcite|correct|drugbank}}
| DrugBank          = DB04599
| ChemSpiderID_Ref  = {{chemspidercite|correct|chemspider}}
| ChemSpiderID      = 2111
| UNII_Ref          = {{fdacite|correct|FDA}}
| UNII              = 
| KEGG_Ref          = {{keggcite|correct|kegg}}
| KEGG              = C13355
| ChEBI_Ref         = {{ebicite|correct|EBI}}
| ChEBI             = 47943
| ChEMBL_Ref        = {{ebicite|correct|EBI}}
| ChEMBL            = 36994
| synonyms          =

<!-- Chemical data -->
|C=12 |H=13 |N=1 |O=3
| molecular_weight  = 219,237
| smiles            = COC1=CC=C(C=C1)C(=O)N1CCCC1=O
| StdInChI          = 1S/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7H,2-3,8H2,1H3
| StdInChIKey_Ref   = {{stdinchicite|correct|chemspider}}
| StdInChI_comment  = 
| StdInChIKey       = ZXNRTKGTQJPIJK-UHFFFAOYSA-N
| StdStdInChI_Ref   = {{stdinchicite|correct|chemspider}}
| density           = 
| melting_point     =  
| melting_high      = 
| melting_notes     = 
| boiling_point     = 
| boiling_notes     = 
| solubility        = 
| specific_rotation = 
| sec_combustion    = 
}}
'''Aniracetam''' je [[organsko jedinjenje]], koje sadrži 12 [[atom]]a [[ugljenik]]a i ima [[Molekulska masa|molekulsku masu]] od 219,237 [[Jedinica atomske mase|Da]].<ref>Nakamura K, Kurasawa M: Anxiolytic effects of aniracetam in three different mouse models of anxiety and the underlying mechanism. Eur J Pharmacol. 2001 May 18;420(1):33-43. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/11412837 11412837]</ref><ref>Lawrence JJ, Brenowitz S, Trussell LO: The mechanism of action of aniracetam at synaptic alpha-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid (AMPA) receptors: indirect and direct effects on desensitization. Mol Pharmacol. 2003 Aug;64(2):269-78. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/12869631 12869631]</ref><ref>{{Cite pmid|21059682}}</ref><ref>{{cite pmid|18048412}}</ref>
== Osobine ==

{| class="wikitable sortable"
|-
! Osobina !! Vrednost
|-
| [[Vodonična veza|Broj akceptora vodonika]] || 3
|-
| [[Vodonična veza|Broj donora vodonika]] || 0
|-
| [[Geometrija molekula|Broj rotacionih veza]] || 2
|-
| [[Particioni koeficijent]]<ref>{{cite doi/10.1021/jp980230o}}</ref> (''ALogP'') || 1,3
|-
| [[Rastvorljivost]]<ref>{{cite pmid|11749573}}</ref> (''logS'', log(''mol/L'')) || -2,0
|-
| [[Polarna površina molekula|Polarna površina]]<ref>{{cite pmid|11020286}}</ref> (''PSA'', [[Angstrem (jedinica)|Å<sup>2</sup>]]) || 46,6 
|}

== Reference ==
{{reflist|2}}

== Literatura ==
{{refbegin}}
* {{GoodmanGilman10th}}
* {{FoyePrinciplesMedChem6th}}
{{refend}}
== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}
{{Commonscat-lat|Aniracetam}}
* [http://www.drugbank.ca/drugs/DB04599 Aniracetam]

{{Glutamatergični ligandi}}

[[Kategorija:Nootropici]]
[[Kategorija:Fenoli]]
[[Kategorija:Acetamidi]]
[[Kategorija:Fenolni etri]]
[[Kategorija:Pirolidini]]
[[Kategorija:Benzamidi]]