Извор странице Ribavirin

{{Drugbox-lat
| IUPAC_name        = 
| image             = Ribavirin-skeletal.svg
| width             = 
| alt               = 
| image2            = Ribavirin ball-and-stick.png
| width2            = 
| alt2              = 
| imagename         = 
| drug_name         = Ribavirin
| caption           = 

<!-- Clinical data -->
| tradename         = -{Copegus, Rebetol, Rebetron, Rebretron}-
| Drugs.com         = {{drugs.com-lat|monograph|Ribavirin}}
| MedlinePlus       = 
| licence_EU        = 
| licence_US        = 
| DailyMedID        = 
| pregnancy_AU      = 
| pregnancy_US      = 
| pregnancy_category= 
| legal_AU          = 
| legal_CA          = 
| legal_UK          = 
| legal_US          = 
| legal_status      = 
| dependency_liability = 
| routes_of_administration = Respiratorno (inhalacija)

<!-- Pharmacokinetic data -->
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 9,5 h
| excretion         = 

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number        = 36791-04-5
| CAS_supplemental  = 
| ATCvet            = 
| ATC_prefix        = J05
| ATC_suffix        = AB04
| ATC_supplemental  = 
| PubChem           = 37542
| PubChemSubstance  = 46505883
| IUPHAR_ligand     = 
| DrugBank_Ref      = {{drugbankcite|correct|drugbank}}
| DrugBank          = DB00811
| ChemSpiderID_Ref  = {{chemspidercite|correct|chemspider}}
| ChemSpiderID      = 34439
| UNII_Ref          = {{fdacite|correct|FDA}}
| UNII              = 
| KEGG_Ref          = {{keggcite|correct|kegg}}
| KEGG              = 
| ChEBI_Ref         = {{ebicite|correct|EBI}}
| ChEBI             = 
| ChEMBL_Ref        = {{ebicite|correct|EBI}}
| ChEMBL            = 1643
| synonyms          = 

<!-- Chemical data -->
|C=8 |H=12 |N=4 |O=5
| molecular_weight  = 244,205
| smiles            = NC(=O)C1=NN(C=N1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
| StdInChI          = 1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1
| StdInChIKey_Ref   = {{stdinchicite|correct|chemspider}}
| StdInChI_comment  = 
| StdInChIKey       = IWUCXVSUMQZMFG-AFCXAGJDSA-N
| StdStdInChI_Ref   = {{stdinchicite|correct|chemspider}}
| density           = 
| melting_point     = 174-176
| melting_high      = 
| melting_notes     = 
| boiling_point     = 
| boiling_notes     = 
| solubility        = 
| specific_rotation = 
| sec_combustion    = 
}}
'''Ribavirin''' je [[organsko jedinjenje]] koje sadrži 8 [[atom]]a [[ugljenik]]a i ima [[Молекулска маса|molekulsku masu]] od 244,205 [[Јединица атомске масе|-{Da}-]].<ref>-{Sidwell RW, Bailey KW, Wong MH, Barnard DL, Smee DF: In vitro and in vivo influenza virus-inhibitory effects of viramidine. Antiviral Res. 2005 Oct;68(1):10-7. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/16087250 16087250]}-</ref><ref>-{Sidwell RW, Huffman JH, Khare GP, Allen LB, Witkowski JT, Robins RK: Broad-spectrum antiviral activity of Virazole: 1-beta-D-ribofuranosyl-1,2,4-triazole-3-carboxamide. Science. 1972 Aug 25;177(50): 705-6. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/4340949 4340949]}-</ref><ref>-{Alvarez D, Dieterich DT, Brau N, Moorehead L, Ball L, Sulkowski MS: Zidovudine use but not weight-based ribavirin dosing impacts anaemia during HCV treatment in HIV-infected persons. J Viral Hepat. 2006 Oct;13(10):683-9. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/16970600 16970600]}-</ref><ref>-{Bani-Sadr F, Carrat F, Pol S, Hor R, Rosenthal E, Goujard C, Morand P, Lunel-Fabiani F, Salmon-Ceron D, Piroth L, Pialoux G, Bentata M, Cacoub P, Perronne C: Risk factors for symptomatic mitochondrial toxicity in HIV/hepatitis C virus-coinfected patients during interferon plus ribavirin-based therapy. J Acquir Immune Defic Syndr. 2005 Sep 1;40(1):47-52. [[PubMed|PMID]] [http://www.ncbi.nlm.nih.gov/pubmed/16123681 16123681]}-</ref><ref>{{Cite pmid|21059682|noedit}}</ref><ref>{{cite pmid|18048412|noedit}}</ref>
== Osobine ==

{| class="wikitable sortable"
|-
! Osobina !! Vrednost
|-
| [[Водонична веза|Broj akceptora vodonika]] || 7
|-
| [[Водонична веза|Broj donora vodonika]] || 4
|-
| Broj rotacionih veza || 3
|-
| [[Particioni koeficijent]]<ref>{{cite doi/10.1021/jp980230o|noedit}}</ref> (-{''ALogP'')}- || -2,7
|-
| [[Rastvorljivost]]<ref>{{cite pmid|11749573|noedit}}</ref> (-{''logS'', log(''mol/L''}-)) || -0,3
|-
| [[Polarna površina]]<ref>{{cite pmid|11020286|noedit}}</ref> (''PSA'', [[Ангстрем (јединица)|Å<sup>2</sup>]]) || 143,7 
|}

== Reference ==
{{reflist}}

== Literatura ==
{{refbegin}}
* {{GoodmanGilman10th}}
* {{FoyePrinciplesMedChem6th}}
{{refend}}
== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}
{{Commonscat-lat|Ribavirin}}
* [http://www.drugbank.ca/drugs/DB00811 -{Ribavirin}-]
{{Medicinsko upozorenje-lat}}

[[Категорија:Антивиротици]] 
[[Категорија:Антиметаболити]] 
[[Категорија:Алкохоли]] 
[[Категорија:Ацетамиди]]