|
|
(27 intermediate revisions by 14 users not shown) |
label / sr | label / sr |
| | Argiotoksin-636 |
description / lb | description / lb |
| chemesch Verbindung
| | cheemesch Verbindung |
description / ru | description / ru |
| | химическое соединение |
description / ks | description / ks |
| | کیٖمیٲیی مُرَکَب |
Property / instance of | |
| | |
Property / instance of: chemical compound / rank | |
| Normal rank
| |
Property / instance of | |
| | |
Property / instance of: argiotoxin / rank | |
| Normal rank
| |
| Property / PubChem CID: 122294 / reference |
| | |
| Property / InChIKey: FTNICLJXPYLDAH-GOTSBHOMSA-N / reference |
| | |
Property / InChI | Property / InChI |
| 1S/C29H52N10O6/c30-22(7-4-15-38-29(32)33)27(44)36-16-6-13-35-12-5-11-34-10-2-1-3-14-37-28(45)23(19-25(31)42)39-26(43)17-20-8-9-21(40)18-24(20)41/h8-9,18,22-23,34-35,40-41H,1-7,10-17,19,30H2,(H2,31,42)(H,36,44)(H,37,45)(H,39,43)(H4,32,33,38)/t22-,23-/m0/s1 | | InChI=1S/C29H52N10O6/c30-22(7-4-15-38-29(32)33)27(44)36-16-6-13-35-12-5-11-34-10-2-1-3-14-37-28(45)23(19-25(31)42)39-26(43)17-20-8-9-21(40)18-24(20)41/h8-9,18,22-23,34-35,40-41H,1-7,10-17,19,30H2,(H2,31,42)(H,36,44)(H,37,45)(H,39,43)(H4,32,33,38)/t22-,23-/m0/s1 |
| Property / ChEBI ID: 34541 / qualifier |
| | |
| Property / ChEBI ID: 34541 / reference |
| | matched by identifier from: International Chemical Identifier InChI: InChI=1S/C29H52N10O6/c30-22(7-4-15-38-29(32)33)27(44)36-16-6-13-35-12-5-11-34-10-2-1-3-14-37-28(45)23(19-25(31)42)39-26(43)17-20-8-9-21(40)18-24(20)41/h8-9,18,22-23,34-35,40-41H,1-7,10-17,19,30H2,(H2,31,42)(H,36,44)(H,37,45)(H,39,43)(H4,32,33,38)/t22-,23-/m0/s1 |
Property / physically interacts with | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 1 / rank | |
| Normal rank
| |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 1 / qualifier | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 1 / reference | |
| | |
Property / physically interacts with | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 2 / rank | |
| Normal rank
| |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 2 / qualifier | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 2 / reference | |
| | |
Property / physically interacts with | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 3 / rank | |
| Normal rank
| |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 3 / qualifier | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 3 / reference | |
| | |
Property / physically interacts with | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 4 / rank | |
| Normal rank
| |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 4 / qualifier | |
| | |
Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 4 / reference | |
| | |
| Property / instance of |
| | |
| Property / instance of: type of chemical entity / rank |
| | Normal rank |
| Property / physically interacts with |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 1 / rank |
| | Normal rank |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 1 / qualifier |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 1 / reference |
| | |
| Property / physically interacts with |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 2 / rank |
| | Normal rank |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 2 / qualifier |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 2 / reference |
| | |
| Property / physically interacts with |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 3 / rank |
| | Normal rank |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 3 / qualifier |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 3 / reference |
| | |
| Property / physically interacts with |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 4 / rank |
| | Normal rank |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 4 / qualifier |
| | |
| Property / physically interacts with: Glutamate ionotropic receptor AMPA type subunit 4 / reference |
| | |
| Property / DSSTox substance ID |
| | |
| Property / DSSTox substance ID: DTXSID60909308 / rank |
| | Normal rank |
| Property / DSSTox substance ID: DTXSID60909308 / reference |
| | |
| Property / DSSTOX compound identifier |
| | |
| Property / DSSTOX compound identifier: DTXCID201338371 / rank |
| | Normal rank |
| Property / PDB ligand ID |
| | |
| Property / PDB ligand ID: LU7 / rank |
| | Normal rank |
| Property / found in taxon |
| | |
| Property / found in taxon: Nephila clavata / rank |
| | Normal rank |
| Property / found in taxon: Nephila clavata / reference |
| | |
| Property / found in taxon |
| | |
| Property / found in taxon: Trichonephila clavata / rank |
| | Normal rank |
| Property / found in taxon: Trichonephila clavata / reference |
| | |
| Property / Google Knowledge Graph ID |
| | |
| Property / Google Knowledge Graph ID: /g/11bc5w52x4 / rank |
| | Normal rank |
| Property / Probes And Drugs ID |
| | |
| Property / Probes And Drugs ID: PD051481 / rank |
| | Normal rank |
| Property / subclass of |
| | |
| Property / subclass of: PA3 polyamine alkaloid / rank |
| | Normal rank |
| Property / subclass of |
| | |
| Property / subclass of: PA5 polyamine alkaloid / rank |
| | Normal rank |
| Property / subclass of |
| | |
| Property / subclass of: argiotoxin / rank |
| | Normal rank |
| Property / UniChem compound ID |
| | |
| Property / UniChem compound ID: 627492 / rank |
| | Normal rank |
| Property / UniChem compound ID: 627492 / reference |
| | |
links / srwiki / name | links / srwiki / name |
| | |