| dbo:abstract
|
- هيتاشيمايسين، المعروف أيضًا باسم ستوبوميسين، هو عديد ببتيد دوري تنتجه الستربتوميسيس الذي يعمل كمضاد حيوي. يُظهر نشاطًا سامًا للخلايا ضد خلايا الثدييات والبكتيريا موجبة الجرام والخميرة والفطريات، فضلاً عن النشاط الانحلالي يتم التوسط في ذلك من خلال التغييرات في غشاء الخلية والتحلل اللاحق. نظرًا لنشاطه السام للخلايا ضد الخلايا والأورام في الثدييات، فقد تم اقتراحه لأول مرة كمضاد حيوي مضاد للأورام . اعتبارًا من عام 2007 ، لم يتم استخدامه في بيئة سريرية. (ar)
- Hitachimycin, also known as stubomycin, is a cyclic polypeptide produced by Streptomyces that acts as an antibiotic. It exhibits cytotoxic activity against mammalian cells, Gram-positive bacteria, yeast, and fungi, as well as hemolytic activity; this is mediated by changes at the cell membrane and subsequent lysis. Owing to its cytotoxic activity against mammalian cells and tumors, it was first proposed as an antitumor antibiotic. As of 2007, it has not been used in a clinical setting. (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2527 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- -1620 (xsd:integer)
- 3 (xsd:integer)
- docosa-2,4,6,12,19-pentaene-8,18-dione (en)
|
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- O[C@H]1CC\C=C\C[C@H]c3ccccc3 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- PLQKHNPZPRTISL-QSQNXQFYSA-N (en)
|
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- هيتاشيمايسين، المعروف أيضًا باسم ستوبوميسين، هو عديد ببتيد دوري تنتجه الستربتوميسيس الذي يعمل كمضاد حيوي. يُظهر نشاطًا سامًا للخلايا ضد خلايا الثدييات والبكتيريا موجبة الجرام والخميرة والفطريات، فضلاً عن النشاط الانحلالي يتم التوسط في ذلك من خلال التغييرات في غشاء الخلية والتحلل اللاحق. نظرًا لنشاطه السام للخلايا ضد الخلايا والأورام في الثدييات، فقد تم اقتراحه لأول مرة كمضاد حيوي مضاد للأورام . اعتبارًا من عام 2007 ، لم يتم استخدامه في بيئة سريرية. (ar)
- Hitachimycin, also known as stubomycin, is a cyclic polypeptide produced by Streptomyces that acts as an antibiotic. It exhibits cytotoxic activity against mammalian cells, Gram-positive bacteria, yeast, and fungi, as well as hemolytic activity; this is mediated by changes at the cell membrane and subsequent lysis. Owing to its cytotoxic activity against mammalian cells and tumors, it was first proposed as an antitumor antibiotic. As of 2007, it has not been used in a clinical setting. (en)
|
| rdfs:label
|
- هيتاشيميسين (ar)
- Hitachimycin (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
