| dbo:abstract
|
- ORG-2058 ، والمعروف أيضًا باسم (16α-ethyl-21-hydroxy-19-norprogesterone) ، هو من مجموعة التي لم يتم تسويقها مطلقًا. له انجذاب كبير لمستقبلات البروجسترون (775٪ من هرمون ) وقد استخدم في البحث العلمي لدراسة دور مستقبلات البروجسترون في الجسم. الدواء ليس له ألفة لمستقبلات هرمون الاستروجين أو (أقل من 0.2٪ من تقاربات استراديول وديكساميثازون ، على التوالي) وله انجذاب طفيف ، ولكن أقل من هرمون البروجسترون. (ar)
- ORG-2058, also known as 16α-ethyl-21-hydroxy-19-norprogesterone, is a progestin of the 19-norprogesterone group which was never marketed. It has high affinity for the progesterone receptor (775% of that of progesterone) and has been used in scientific research to study the role of the progesterone receptor in the body. The drug has no affinity for the estrogen receptor or the glucocorticoid receptor (less than 0.2% of the affinities of estradiol and dexamethasone, respectively) and has slight affinity for the mineralocorticoid receptor, but less than that of progesterone. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4045 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CC[C@@H]1C[C@H]2[C@@H]3CCC4=CCCC[C@@H]4[C@H]3CC[C@@]2C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- IJLXLZGJDSJGIQ-BILPMHSYSA-N (en)
|
| dbp:synonyms
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- ORG-2058 ، والمعروف أيضًا باسم (16α-ethyl-21-hydroxy-19-norprogesterone) ، هو من مجموعة التي لم يتم تسويقها مطلقًا. له انجذاب كبير لمستقبلات البروجسترون (775٪ من هرمون ) وقد استخدم في البحث العلمي لدراسة دور مستقبلات البروجسترون في الجسم. الدواء ليس له ألفة لمستقبلات هرمون الاستروجين أو (أقل من 0.2٪ من تقاربات استراديول وديكساميثازون ، على التوالي) وله انجذاب طفيف ، ولكن أقل من هرمون البروجسترون. (ar)
- ORG-2058, also known as 16α-ethyl-21-hydroxy-19-norprogesterone, is a progestin of the 19-norprogesterone group which was never marketed. It has high affinity for the progesterone receptor (775% of that of progesterone) and has been used in scientific research to study the role of the progesterone receptor in the body. The drug has no affinity for the estrogen receptor or the glucocorticoid receptor (less than 0.2% of the affinities of estradiol and dexamethasone, respectively) and has slight affinity for the mineralocorticoid receptor, but less than that of progesterone. (en)
|
| rdfs:label
|
- ORG-2058 (ar)
- ORG-2058 (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
