| dbo:abstract
|
- Testosterone isobutyrate, sold under the brand names Agovirin-Depot and Perandren M among others, is an androgen and anabolic steroid medication and a testosterone ester which is used for indications such as low testosterone levels in men and delayed puberty in boys. It is available only in the Czech Republic and Slovakia. The medication is administered by injection into muscle once every 1 to 2 weeks in males. Unlike most other testosterone esters, which are provided as oil solutions, testosterone isobutyrate is formulated as a microcrystalline aqueous suspension. (en)
|
| dbo:alternativeName
|
- Agovirin-Depot, Perandren M, Testocryst, Virex-Cryst (en)
|
| dbo:casNumber
| |
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 14615 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:durationOfAction
| |
| dbp:h
| |
| dbp:image
|
- Testosterone isobutyrate molecule ball.png (en)
|
| dbp:iupacName
|
- [-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-methylpropanoate (en)
|
| dbp:metabolites
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- CCCO[C@H]1CC[C@@H]2[C@@]1C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- PYHZLMFTKOTWGQ-WAUHAFJUSA-N (en)
|
| dbp:tradename
|
- Agovirin-Depot, Perandren M, Testocryst, Virex-Cryst (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Testosterone isobutyrate, sold under the brand names Agovirin-Depot and Perandren M among others, is an androgen and anabolic steroid medication and a testosterone ester which is used for indications such as low testosterone levels in men and delayed puberty in boys. It is available only in the Czech Republic and Slovakia. The medication is administered by injection into muscle once every 1 to 2 weeks in males. Unlike most other testosterone esters, which are provided as oil solutions, testosterone isobutyrate is formulated as a microcrystalline aqueous suspension. (en)
|
| rdfs:label
|
- Testosterone isobutyrate (en)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is dbp:caption
of | |
| is rdfs:seeAlso
of | |
| is owl:differentFrom
of | |
| is foaf:primaryTopic
of | |
