Jump to content

Imidapril: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
added chembl id
CheMoBot (talk | contribs)
Updating {{drugbox}} (changes to verified fields - updated 'ChEMBL_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or bugs)
Line 40: Line 40:
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4576628
| ChemSpiderID = 4576628
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 317094
| ChEMBL = 317094
| SMILES = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)OCC)CCc1ccccc1)C)C(=O)N(C)C2
| SMILES = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)OCC)CCc1ccccc1)C)C(=O)N(C)C2

Revision as of 15:02, 21 February 2012

{{Drugbox | Verifiedfields = changed | verifiedrevid = 444377257 | IUPAC_name = (4S)-3-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylic acid | image = Imidapril structure.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  checkY | CAS_number = 89371-37-9 | ATC_prefix = C09 | ATC_suffix = AA16 | ATC_supplemental = | PubChem = 5464343 | DrugBank_Ref =  checkY | DrugBank = | UNII_Ref =  checkY | UNII = BW7H1TJS22 | KEGG_Ref =  checkY | KEGG = D08068 | ChemSpiderID_Ref =  ☒N | ChemSpiderID = 4576628 | ChEMBL_Ref =  ☒N | ChEMBL = 317094 | SMILES = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)OCC)CCc1ccccc1)C)C(=O)N(C)C2 | InChI = 1/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1 | InChIKey = KLZWOWYOHUKJIG-BPUTZDHNBX | StdInChI_Ref =  ☒N | StdInChI = 1S/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1 | StdInChIKey_Ref =  ☒N | StdInChIKey = KLZWOWYOHUKJIG-BPUTZDHNSA-N

| chemical_formula = | C=20 | H=27 | N=3 | O=6 | molecular_weight = 405.444 g/mol }}

Imidapril (INN) is an ACE inhibitor used as an antihypertensive drug and for the treatment of chronic heart failure.[1]

References

  1. ^ PMID 17547476