Scribd Logo
Upload

Welcome to Scribd!

  • 245 views

    Chemistry 120 Review - Finals

    Uploaded by

    phant2phan
    1. The document contains questions about chemistry topics including organic functional groups, isomerism, IUPAC naming, reactions. 2. Questions cover hybridization of alkynes, number of isomers of neopentane, functional groups in vanillin, saponification reaction. 3. Reactions include oxidation of alcohols with PCC, halogenation of alkanes, addition reactions of alkenes and alkynes. Structure, linkages and properties of carbohydrates like glycogen, cellulose, starch and reducing sugars are also discussed.

    Copyright:

    Attribution Non-Commercial (BY-NC)
    Download as DOCX, PDF, TXT or read online from Scribd

    Chemistry 120 Review - Finals

    Uploaded by

    phant2phan
    245 views2 pages
    1. The document contains questions about chemistry topics including organic functional groups, isomerism, IUPAC naming, reactions. 2. Questions cover hybridization of alkynes, number of isomers of neopentane, functional groups in vanillin, saponification reaction. 3. Reactions include oxidation of alcohols with PCC, halogenation of alkanes, addition reactions of alkenes and alkynes. Structure, linkages and properties of carbohydrates like glycogen, cellulose, starch and reducing sugars are also discussed.

    Original Description:

    Original Title

    Chemistry 120 Review_finals[1]

    Copyright

    © Attribution Non-Commercial (BY-NC)

    Available Formats

    DOCX, PDF, TXT or read online from Scribd

    Did you find this document useful?

    Is this content inappropriate?

    1. The document contains questions about chemistry topics including organic functional groups, isomerism, IUPAC naming, reactions. 2. Questions cover hybridization of alkynes, number of isomers of neopentane, functional groups in vanillin, saponification reaction. 3. Reactions include oxidation of alcohols with PCC, halogenation of alkanes, addition reactions of alkenes and alkynes. Structure, linkages and properties of carbohydrates like glycogen, cellulose, starch and reducing sugars are also discussed.

    Copyright:

    Attribution Non-Commercial (BY-NC)
    Download as DOCX, PDF, TXT or read online from Scribd
    Download as docx, pdf, or txt
    245 views2 pages

    Chemistry 120 Review - Finals

    Uploaded by

    phant2phan
    1. The document contains questions about chemistry topics including organic functional groups, isomerism, IUPAC naming, reactions. 2. Questions cover hybridization of alkynes, number of isomers of neopentane, functional groups in vanillin, saponification reaction. 3. Reactions include oxidation of alcohols with PCC, halogenation of alkanes, addition reactions of alkenes and alkynes. Structure, linkages and properties of carbohydrates like glycogen, cellulose, starch and reducing sugars are also discussed.

    Copyright:

    Attribution Non-Commercial (BY-NC)
    Download as DOCX, PDF, TXT or read online from Scribd
    Download as docx, pdf, or txt
    of 2

    Chemistry review

    1. The hybridization and shape of alkynes is:


    a) sp3, trigonal planar b) sp2, linear c) sp, linear d) sp3, tetrahedral
    1. The carbons in a triple bond has what hybridization between them:
    a) sp3 b) sp2 c) sp-sp d) sp2-sp3 e) sp f) sp2-sp
    2. How many dichloro substituted isomers can be written for neopentane:
    a) 1 b) 2 c) 3 d) 4 e) 5 f) 6 g) 9
    3. 2,3,5-trimethylhexane has how many primary, secondary and tertiary carbons?
    4. How many isomers does 2-butene have?
    5. How many isomers will have the molecular formula C4H8?
    6. Molecular formula for 2-bromo-2,3-dichloropentane?
    a) C5H8Cl2Br b) C5H9Cl2Br c) C5H9ClBr d) C5H7Cl2Br
    7. Alkynes and cycloalkene are isomers. A) True B) False
    8. Alcohols and aldehydes are….? a) nonpolar b) ionic c) hydrophobic d) polar
    9. Dehydration of alcohols produces..? a) alkanes b) cycloalkanes c) alkenes d) alkynes
    10. Addition of constituents to benzene is an example of..?
    a) elimination b) substitution c) addition d) elimination/substitution
    1. This compound has how many pi (π ) electrons and sigma electrons? CH2CHCHCHCCCHCHCHCHCH2CCH
    2. What is the IUPAC name for this compound? CH3CH2C(CH3)2CH(Br)C(CH3)2 CH2CH(CH3)2.
    3. The halogenation of alkanes is an example of..?
    a) elimination b) substitution c) addition d) elimination/substitution
    1. The disappearance of the purple color of KMnO4 in a reaction with an alkene is known as the?
    a) Seytsef test b) Biuret test c) Baeyr test c) Tollen test d) Benedict test
    1. CH3C(CH3) = CH2 + H2/Pt→ ?16b. CH3C (CH3) = CH2; Will 16b form Cis or Trans isomers?
    2. CH3C(CH3) = CH2 + HCl → ?
    3. CH3C ≡ CH + 2HBr → ?
    4. What type of reactions do alkynes and alkenes undergo?
    5. The catalyst commonly use for the alkylation of benzene with CH3CH2Cl is..?
    a) AlCl3 b) FeCl3 c) KMnO4 d) H2/Pt e) H+/H2SO4
    20a. The monomer for polyvinyl chloride is?
    a) CH2= CHCl b) CH2= CCl2 c) CF2=CF2 d) CH2=CHCN e) CH2=CH2
    6. The treatment of propylbenene with KMnO4 solution produces a:
    a) benzoic acid/CO2 b) benzoic acid/CH3CO2H c) benzoic acid/ CH3COH d) no reaction

    1. Oxidation of 2-propanol with PCC gives?


    2. Oxidation of 1-propanol with PCC gives?
    3. Alcohols are more acidic than phenols. A) True B) False
    4. Name this compound? (CH3)2CHClCH(SH)CH2CH3
    5. The reaction between a hemiacetal and an alcohol produces a?
    6. The reaction between two alcohol (in H+/heat) produces what kind of compound a?
    7. Vanillin has all of the following groups except? a) phenol b) methoxy c) aldehyde d) ethyl f) aromatic ring
    8. Isopropyl alcohol is also called? a) drinking alcohol b) rubbing alcohol c) ethylene glycol d) wood alcohol
    9. In the Williamson synthesis a propylbromide reacts with sodium ethoxide to give?
    a) CH3CH2CH2O CH2CH2CH3 b) CH3CH2CH2O Na c) CH3CH2CH2OCH2CH3 d) CH3CH2O CH2CH3
    30. During intramolecular dehydration of alcohols, the major product is the alkene in which the carbon-carbon double bond has the
    greatest number of alkyl substituent on it. This is called?
    a) Markovnikov’s rule b) Saytzeff’s rule c) Seliwanov’s rule d) Tollens rule e) Biuret rule
    31. Of all the classes of compounds which include, alkane-ether-ester-aldehyde-ketone-alcohol-carboxylic acid, which has the higher
    boiling point?
    32. Compound X has an enantiomer that has an optical rotation of (-) and two chiral center at carbon 2, and 3 and which shows at 2S,
    3R stereochemistry? What is the optical rotation and stereochemistry of compound X?
    34. What is Saponification?
    35. Name the compound that is produced from the combination of 2-methylbutanoic acid and 2-butanol?
    36. If a protein is said to contain an alpha helix and/or a beta-pleated sheet, what level of protein structure is it?
    38. What is soap? Are soaps of Ca+2, Fe+2, and Mg+2 soaps soluble in hard water?
    39. Which of these is not an essential fatty acid? a) Oleic b) Arachidonic c) Linoleic acid d) Linolenic acid
    40. How many essential amino acids are there? What are they?
    41. Phenylalanine + NaOH → ?
    42. Which of these compounds does not give a positive Biuret test? a) ser-gly b) ser-cys-tyr c) ala-glu-pro d) lys-asp-arg
    43. Which of these are not true concerning D-Glucose and D-Galactose? They are? a) monosaccharides b) reducing sugars c)
    both are found in lactose d) both ketohexose.
    44. Which of these are not reducing sugar? a) D-Glucose b) D-Galactose c) fructose d) sucrose
    45. Which is not true about reducing ability of sugars? It depends on their…? a) aldehyde group b) a-hydroxyketone groups
    c) ability to form kemiacetal structures d) ability to form D- and L
    46. Are D-glucose and D-galactose epimers?
    47. Which of these amino acids will form disulfide linkage in protein? a) glycine b) phenylalanine c) serine d) cysteine
    48. Which of these will form β-(1,4) linkages? a) glycogen b) cellulose c) starch d) amylase
    49. Which of these form α-(1,6) linkages? a) glycogen b) cellulose c) amylose d) amylopectin e) A & D
    50. Which of these do not contain α-(1,4) linkages? a) glycogen b) cellulose c) amylose d) amylopectin
    51.Which of these will not contain give a color with iodine? a) glycogen b) cellulose c) amylose d) amylopectin
    52. Which of these is an omega-3 (ω-3) fatty acid? a) arachidonic acid b) oleic acid c) linolenic acid d) linoleic acid
    53. Which is not true concerning 1,2,3-propanetriol? a) an alcohol b) glycerol c) found in soap d) produce an alcohol upon acid
    hydrolysis of triglycerides
    Complete these reactions (43-46)
    43.
    R
    +
    H3N C COO- + NaOH
    H

    44.
    CH3 CH2OH
    + +
    H3N C COO- + H3N C COO-
    H H
    4 5.
    OH

    HOH2C C CH2OH + 3 CH3(CH2)7COOH


    H
    46.
    O
    CH2O C (CH2)14CH3
    O
    H C O C (CH2)7CH=CH(CH2)7CH3
    O
    + 3 NaOH
    CH2O C (CH2)7CH=CH(CH2)7CH3

    You might also like